C18H20N2O4 — CID 23948201
(E,5R)-N-(2-aminophenyl)-5-hydroxy-5-(3-hydroxy-4-methoxyphenyl)pent-2-enamide (PubChem CID 23948201) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E,5R)-N-(2-aminophenyl)-5-hydroxy-5-(3-hydroxy-4-methoxyphenyl)pent-2-enamide.
| Compound Name | (E,5R)-N-(2-aminophenyl)-5-hydroxy-5-(3-hydroxy-4-methoxyphenyl)pent-2-enamide |
|---|---|
| PubChem CID | 23948201 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (E,5R)-N-(2-aminophenyl)-5-hydroxy-5-(3-hydroxy-4-methoxyphenyl)pent-2-enamide |
| SMILES | COc1ccc([C@H](O)C/C=C/C(=O)Nc2ccccc2N)cc1O |
| InChI | InChI=1S/C18H20N2O4/c1-24-17-10-9-12(11-16(17)22)15(21)7-4-8-18(23)20-14-6-3-2-5-13(14)19/h2-6,8-11,15,21-22H,7,19H2,1H3,(H,20,23)/b8-4+/t15-/m1/s1 |
| InChIKey | PPFOXDYQIIXULX-SGJXGLNRSA-N |
| XLogP | 2.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|