C22H28N2O4 — CID 23864980
(E,6S,7S)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enamide (PubChem CID 23864980) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (E,6S,7S)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enamide.
| Compound Name | (E,6S,7S)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enamide |
|---|---|
| PubChem CID | 23864980 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (E,6S,7S)-N-(2-aminophenyl)-7-hydroxy-7-[4-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enamide |
| SMILES | C[C@@H](CC/C=C/C(=O)Nc1ccccc1N)[C@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-16(22(27)17-10-12-18(13-11-17)28-15-14-25)6-2-5-9-21(26)24-20-8-4-3-7-19(20)23/h3-5,7-13,16,22,25,27H,2,6,14-15,23H2,1H3,(H,24,26)/b9-5+/t16-,22-/m0/s1 |
| InChIKey | OSIGOMHBOMSMHM-JNCNWGKYSA-N |
| XLogP | 3.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|