C21H30O5 — CID 23760348
ethyl (2E,4E,8R,9S)-9-hydroxy-9-[4-(2-hydroxyethoxy)phenyl]-3,8-dimethylnona-2,4-dienoate (PubChem CID 23760348) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl (2E,4E,8R,9S)-9-hydroxy-9-[4-(2-hydroxyethoxy)phenyl]-3,8-dimethylnona-2,4-dienoate.
| Compound Name | ethyl (2E,4E,8R,9S)-9-hydroxy-9-[4-(2-hydroxyethoxy)phenyl]-3,8-dimethylnona-2,4-dienoate |
|---|---|
| PubChem CID | 23760348 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | ethyl (2E,4E,8R,9S)-9-hydroxy-9-[4-(2-hydroxyethoxy)phenyl]-3,8-dimethylnona-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/CC[C@@H](C)[C@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C21H30O5/c1-4-25-20(23)15-16(2)7-5-6-8-17(3)21(24)18-9-11-19(12-10-18)26-14-13-22/h5,7,9-12,15,17,21-22,24H,4,6,8,13-14H2,1-3H3/b7-5+,16-15+/t17-,21+/m1/s1 |
| InChIKey | YZUGPNVWAMLTIF-YUSYOZLQSA-N |
| XLogP | 3.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|