C16H23NO5 — CID 23874742
(E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2,3,4-trimethylpent-2-enamide (PubChem CID 23874742) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is (E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2,3,4-trimethylpent-2-enamide.
| Compound Name | (E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2,3,4-trimethylpent-2-enamide |
|---|---|
| PubChem CID | 23874742 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (E,4R,5R)-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2,3,4-trimethylpent-2-enamide |
| SMILES | C/C(C(=O)NO)=C(/C)[C@@H](C)[C@@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C16H23NO5/c1-10(12(3)16(20)17-21)11(2)15(19)13-4-6-14(7-5-13)22-9-8-18/h4-7,11,15,18-19,21H,8-9H2,1-3H3,(H,17,20)/b12-10+/t11-,15-/m1/s1 |
| InChIKey | LAAOYUKVVUXIIS-CSUUCDFFSA-N |
| XLogP | 1.57 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|