C15H21NO6 — CID 23920856
(E,4R,5R)-4-ethoxy-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]pent-2-enamide (PubChem CID 23920856) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is (E,4R,5R)-4-ethoxy-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]pent-2-enamide.
| Compound Name | (E,4R,5R)-4-ethoxy-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]pent-2-enamide |
|---|---|
| PubChem CID | 23920856 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (E,4R,5R)-4-ethoxy-N,5-dihydroxy-5-[4-(2-hydroxyethoxy)phenyl]pent-2-enamide |
| SMILES | CCO[C@H](/C=C/C(=O)NO)[C@H](O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C15H21NO6/c1-2-21-13(7-8-14(18)16-20)15(19)11-3-5-12(6-4-11)22-10-9-17/h3-8,13,15,17,19-20H,2,9-10H2,1H3,(H,16,18)/b8-7+/t13-,15-/m1/s1 |
| InChIKey | JUOMJKWUQWBCNZ-KHGFPJFYSA-N |
| XLogP | 0.56 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|