C28H31N3O6 — CID 23921063
[(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-phenylcarbamate (PubChem CID 23921063) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-phenylcarbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23921063 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-phenylcarbamate |
| SMILES | CCO[C@H](/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccccc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C28H31N3O6/c1-2-35-25(16-17-26(33)31-24-11-7-6-10-23(24)29)27(20-12-14-22(15-13-20)36-19-18-32)37-28(34)30-21-8-4-3-5-9-21/h3-17,25,27,32H,2,18-19,29H2,1H3,(H,30,34)(H,31,33)/b17-16+/t25-,27-/m1/s1 |
| InChIKey | FJXIVZJZSSQODA-IJTCXXFASA-N |
| XLogP | 4.53 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|