C30H35N3O6S — CID 23836972
[(E,1S,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23836972) has the molecular formula C30H35N3O6S and a molecular weight of 565.69 g/mol. Its IUPAC name is [(E,1S,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1S,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23836972 |
| Molecular Formula | C30H35N3O6S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | [(E,1S,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CO[C@@H](CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccc(SC)cc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C30H35N3O6S/c1-37-27(9-5-6-10-28(35)33-26-8-4-3-7-25(26)31)29(21-11-15-23(16-12-21)38-20-19-34)39-30(36)32-22-13-17-24(40-2)18-14-22/h3-4,6-8,10-18,27,29,34H,5,9,19-20,31H2,1-2H3,(H,32,36)(H,33,35)/b10-6+/t27-,29-/m0/s1 |
| InChIKey | MWBYANUXLBXRFP-BNJZCIJWSA-N |
| XLogP | 5.64 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|