C28H28N4O5 — CID 23948934
[(E,1R,2R)-5-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23948934) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23948934 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | C[C@H](/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccc(C#N)cc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C28H28N4O5/c1-19(6-15-26(34)32-25-5-3-2-4-24(25)30)27(21-9-13-23(14-10-21)36-17-16-33)37-28(35)31-22-11-7-20(18-29)8-12-22/h2-15,19,27,33H,16-17,30H2,1H3,(H,31,35)(H,32,34)/b15-6+/t19-,27-/m1/s1 |
| InChIKey | RWPWAHTVMWKULS-WNSRSKMTSA-N |
| XLogP | 4.63 |
| TPSA | 146.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|