C29H30N4O6 — CID 23750171
[(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23750171) has the molecular formula C29H30N4O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23750171 |
| Molecular Formula | C29H30N4O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-2-ethoxy-1-[4-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | CCO[C@H](/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C29H30N4O6/c1-2-37-26(15-16-27(35)33-25-6-4-3-5-24(25)31)28(21-9-13-23(14-10-21)38-18-17-34)39-29(36)32-22-11-7-20(19-30)8-12-22/h3-16,26,28,34H,2,17-18,31H2,1H3,(H,32,36)(H,33,35)/b16-15+/t26-,28-/m1/s1 |
| InChIKey | XZEXVXNWLOXHQP-KYWSGYILSA-N |
| XLogP | 4.40 |
| TPSA | 155.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|