C23H25N3O7 — CID 23865011
[(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23865011) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is [(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23865011 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [(E,1R,2R)-2-ethoxy-5-(hydroxyamino)-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | CCO[C@H](/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1ccccc1OCCO |
| InChI | InChI=1S/C23H25N3O7/c1-2-31-20(11-12-21(28)26-30)22(18-5-3-4-6-19(18)32-14-13-27)33-23(29)25-17-9-7-16(15-24)8-10-17/h3-12,20,22,27,30H,2,13-14H2,1H3,(H,25,29)(H,26,28)/b12-11+/t20-,22-/m1/s1 |
| InChIKey | GWYQHSSVCOCFIR-LAEIETDRSA-N |
| XLogP | 2.69 |
| TPSA | 150.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|