C25H28N2O6 — CID 23836713
(E,7S)-7-[(4-cyanophenyl)carbamoyloxy]-7-[2-(2-hydroxyethoxy)phenyl]-6,6-dimethylhept-2-enoic acid (PubChem CID 23836713) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (E,7S)-7-[(4-cyanophenyl)carbamoyloxy]-7-[2-(2-hydroxyethoxy)phenyl]-6,6-dimethylhept-2-enoic acid.
| Compound Name | (E,7S)-7-[(4-cyanophenyl)carbamoyloxy]-7-[2-(2-hydroxyethoxy)phenyl]-6,6-dimethylhept-2-enoic acid |
|---|---|
| PubChem CID | 23836713 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (E,7S)-7-[(4-cyanophenyl)carbamoyloxy]-7-[2-(2-hydroxyethoxy)phenyl]-6,6-dimethylhept-2-enoic acid |
| SMILES | CC(C)(CC/C=C/C(=O)O)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1ccccc1OCCO |
| InChI | InChI=1S/C25H28N2O6/c1-25(2,14-6-5-9-22(29)30)23(20-7-3-4-8-21(20)32-16-15-28)33-24(31)27-19-12-10-18(17-26)11-13-19/h3-5,7-13,23,28H,6,14-16H2,1-2H3,(H,27,31)(H,29,30)/b9-5+/t23-/m1/s1 |
| InChIKey | SDROSAZIQZMSCG-DXSBJVNVSA-N |
| XLogP | 4.67 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|