C34H37N3O5 — CID 23836710
[(E,1S)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate (PubChem CID 23836710) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is [(E,1S)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(E,1S)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 23836710 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [(E,1S)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
| SMILES | CC(C)(CC/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1cccc2ccccc12)c1ccccc1OCCO |
| InChI | InChI=1S/C34H37N3O5/c1-34(2,21-10-9-20-31(39)36-29-17-7-6-16-27(29)35)32(26-15-5-8-19-30(26)41-23-22-38)42-33(40)37-28-18-11-13-24-12-3-4-14-25(24)28/h3-9,11-20,32,38H,10,21-23,35H2,1-2H3,(H,36,39)(H,37,40)/b20-9+/t32-/m1/s1 |
| InChIKey | COTSQXBFRVKCBG-IRLYKYNYSA-N |
| XLogP | 7.08 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|