C33H35N3O5 — CID 23892950
[(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate (PubChem CID 23892950) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 23892950 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
| SMILES | C[C@H](CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1cccc2ccccc12)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C33H35N3O5/c1-23(10-2-7-19-31(38)35-30-17-6-5-16-28(30)34)32(25-13-8-14-26(22-25)40-21-20-37)41-33(39)36-29-18-9-12-24-11-3-4-15-27(24)29/h3-9,11-19,22-23,32,37H,2,10,20-21,34H2,1H3,(H,35,38)(H,36,39)/b19-7+/t23-,32-/m1/s1 |
| InChIKey | PBPYIPMHNYRNCJ-GJOXYUDVSA-N |
| XLogP | 6.69 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|