C27H29NO6 — CID 23976838
(E,6S,7R)-7-[2-(2-hydroxyethoxy)phenyl]-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid (PubChem CID 23976838) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is (E,6S,7R)-7-[2-(2-hydroxyethoxy)phenyl]-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid.
| Compound Name | (E,6S,7R)-7-[2-(2-hydroxyethoxy)phenyl]-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid |
|---|---|
| PubChem CID | 23976838 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (E,6S,7R)-7-[2-(2-hydroxyethoxy)phenyl]-6-methyl-7-(naphthalen-1-ylcarbamoyloxy)hept-2-enoic acid |
| SMILES | C[C@@H](CC/C=C/C(=O)O)[C@@H](OC(=O)Nc1cccc2ccccc12)c1ccccc1OCCO |
| InChI | InChI=1S/C27H29NO6/c1-19(9-2-7-16-25(30)31)26(22-13-5-6-15-24(22)33-18-17-29)34-27(32)28-23-14-8-11-20-10-3-4-12-21(20)23/h3-8,10-16,19,26,29H,2,9,17-18H2,1H3,(H,28,32)(H,30,31)/b16-7+/t19-,26+/m0/s1 |
| InChIKey | LIBRLDORTSCCGF-UKLKLFEASA-N |
| XLogP | 5.56 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|