C30H33N3O7 — CID 23779094
[(E,1R,2R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23779094) has the molecular formula C30H33N3O7 and a molecular weight of 547.61 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23779094 |
| Molecular Formula | C30H33N3O7 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | C[C@H](CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccccc1OCCO |
| InChI | InChI=1S/C30H33N3O7/c1-20(8-2-7-13-28(35)33-24-11-5-4-10-23(24)31)29(22-9-3-6-12-25(22)37-17-16-34)40-30(36)32-21-14-15-26-27(18-21)39-19-38-26/h3-7,9-15,18,20,29,34H,2,8,16-17,19,31H2,1H3,(H,32,36)(H,33,35)/b13-7+/t20-,29-/m1/s1 |
| InChIKey | YNPMEJDRKNKCJB-NGIGCPGRSA-N |
| XLogP | 5.27 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|