C28H29Br2N3O4 — CID 23920539
[(E,1S,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate (PubChem CID 23920539) has the molecular formula C28H29Br2N3O4 and a molecular weight of 631.37 g/mol. Its IUPAC name is [(E,1S,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate.
| Compound Name | [(E,1S,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 23920539 |
| Molecular Formula | C28H29Br2N3O4 |
| Molecular Weight | 631.37 g/mol |
| Exact Mass | 629.05 |
| IUPAC Name | [(E,1S,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)O[C@H](c2cc(Br)cc(Br)c2O)[C@H](C)CC/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C28H29Br2N3O4/c1-17-11-13-20(14-12-17)32-28(36)37-27(21-15-19(29)16-22(30)26(21)35)18(2)7-3-6-10-25(34)33-24-9-5-4-8-23(24)31/h4-6,8-16,18,27,35H,3,7,31H2,1-2H3,(H,32,36)(H,33,34)/b10-6+/t18-,27+/m1/s1 |
| InChIKey | DMZKORVSEQAUHO-LGPQPFAUSA-N |
| XLogP | 7.71 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.37 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|