C30H35N3O5 — CID 23865233
[(E,1R,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate (PubChem CID 23865233) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is [(E,1R,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate.
| Compound Name | [(E,1R,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 23865233 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | [(E,1R,2S)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)O[C@@H](c2ccc(OCCO)cc2)[C@@H](C)CC/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C30H35N3O5/c1-21-11-15-24(16-12-21)32-30(36)38-29(23-13-17-25(18-14-23)37-20-19-34)22(2)7-3-6-10-28(35)33-27-9-5-4-8-26(27)31/h4-6,8-18,22,29,34H,3,7,19-20,31H2,1-2H3,(H,32,36)(H,33,35)/b10-6+/t22-,29+/m0/s1 |
| InChIKey | OACHQKMNSALKTI-PMNQWGLWSA-N |
| XLogP | 5.85 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|