C30H32N4O6 — CID 23808140
[(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23808140) has the molecular formula C30H32N4O6 and a molecular weight of 544.61 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23808140 |
| Molecular Formula | C30H32N4O6 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methoxy-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | CO[C@H](CC/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C30H32N4O6/c1-38-27(11-4-5-12-28(36)34-26-10-3-2-9-25(26)32)29(22-7-6-8-24(19-22)39-18-17-35)40-30(37)33-23-15-13-21(20-31)14-16-23/h2-3,5-10,12-16,19,27,29,35H,4,11,17-18,32H2,1H3,(H,33,37)(H,34,36)/b12-5+/t27-,29-/m1/s1 |
| InChIKey | HSHQLONBFBFINH-NBBASUMPSA-N |
| XLogP | 4.79 |
| TPSA | 155.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|