C33H29FN4O5 — CID 23976679
[(E,1R,2R)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23976679) has the molecular formula C33H29FN4O5 and a molecular weight of 580.62 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23976679 |
| Molecular Formula | C33H29FN4O5 |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | N#Cc1ccc(NC(=O)O[C@H](c2ccc(O)c(F)c2)[C@@H](CC/C=C/C(=O)Nc2ccccc2N)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H29FN4O5/c34-26-20-23(16-19-29(26)39)32(43-33(41)37-24-17-14-22(21-35)15-18-24)30(42-25-8-2-1-3-9-25)12-6-7-13-31(40)38-28-11-5-4-10-27(28)36/h1-5,7-11,13-20,30,32,39H,6,12,36H2,(H,37,41)(H,38,40)/b13-7+/t30-,32-/m1/s1 |
| InChIKey | FHFFYLIDLBAHOA-BHOFRCBESA-N |
| XLogP | 6.70 |
| TPSA | 146.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|