C22H25FN2O6 — CID 23807938
[(E,1R,2R)-2-ethoxy-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate (PubChem CID 23807938) has the molecular formula C22H25FN2O6 and a molecular weight of 432.45 g/mol. Its IUPAC name is [(E,1R,2R)-2-ethoxy-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate.
| Compound Name | [(E,1R,2R)-2-ethoxy-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23807938 |
| Molecular Formula | C22H25FN2O6 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(E,1R,2R)-2-ethoxy-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate |
| SMILES | CCO[C@H](CC/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccccc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C22H25FN2O6/c1-2-30-19(10-6-7-11-20(27)25-29)21(15-12-13-18(26)17(23)14-15)31-22(28)24-16-8-4-3-5-9-16/h3-5,7-9,11-14,19,21,26,29H,2,6,10H2,1H3,(H,24,28)(H,25,27)/b11-7+/t19-,21-/m1/s1 |
| InChIKey | BJOWSKQWROMIEI-RZPVRENCSA-N |
| XLogP | 4.07 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|