C20H21FN2O5 — CID 23892676
[(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate (PubChem CID 23892676) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is [(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate.
| Compound Name | [(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23892676 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-7-oxohept-5-enyl] N-phenylcarbamate |
| SMILES | O=C(/C=C/CCC[C@@H](OC(=O)Nc1ccccc1)c1ccc(O)c(F)c1)NO |
| InChI | InChI=1S/C20H21FN2O5/c21-16-13-14(11-12-17(16)24)18(9-5-2-6-10-19(25)23-27)28-20(26)22-15-7-3-1-4-8-15/h1,3-4,6-8,10-13,18,24,27H,2,5,9H2,(H,22,26)(H,23,25)/b10-6+/t18-/m1/s1 |
| InChIKey | DCTMEDRSRCMGDJ-WGLAMXGCSA-N |
| XLogP | 4.05 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|