C25H23N3O5 — CID 23749590
[(E,1S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23749590) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is [(E,1S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23749590 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | [(E,1S)-7-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | N#Cc1ccc(NC(=O)O[C@@H](CCC/C=C/C(=O)NO)c2ccc(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23N3O5/c26-16-17-10-12-18(13-11-17)27-25(31)33-23(8-2-1-3-9-24(30)28-32)21-14-15-22(29)20-7-5-4-6-19(20)21/h3-7,9-15,23,29,32H,1-2,8H2,(H,27,31)(H,28,30)/b9-3+/t23-/m0/s1 |
| InChIKey | OGUBOSCWQNVCPZ-BSQRELMASA-N |
| XLogP | 4.94 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|