C30H28BrN3O4 — CID 23864607
[(E,1S)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23864607) has the molecular formula C30H28BrN3O4 and a molecular weight of 574.48 g/mol. Its IUPAC name is [(E,1S)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23864607 |
| Molecular Formula | C30H28BrN3O4 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | [(E,1S)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
| SMILES | Nc1ccccc1NC(=O)/C=C/CCC[C@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C30H28BrN3O4/c31-20-14-16-21(17-15-20)33-30(37)38-28(24-18-19-27(35)23-9-5-4-8-22(23)24)12-2-1-3-13-29(36)34-26-11-7-6-10-25(26)32/h3-11,13-19,28,35H,1-2,12,32H2,(H,33,37)(H,34,36)/b13-3+/t28-/m0/s1 |
| InChIKey | AENBKEFMSGFICG-SCVCEMNSSA-N |
| XLogP | 7.55 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|