C27H28IN3O4S — CID 23749818
[(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23749818) has the molecular formula C27H28IN3O4S and a molecular weight of 617.51 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23749818 |
| Molecular Formula | C27H28IN3O4S |
| Molecular Weight | 617.51 g/mol |
| Exact Mass | 617.08 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@H](CCC/C=C/C(=O)Nc2ccccc2N)c2cc(I)ccc2O)cc1 |
| InChI | InChI=1S/C27H28IN3O4S/c1-36-20-14-12-19(13-15-20)30-27(34)35-25(21-17-18(28)11-16-24(21)32)9-3-2-4-10-26(33)31-23-8-6-5-7-22(23)29/h4-8,10-17,25,32H,2-3,9,29H2,1H3,(H,30,34)(H,31,33)/b10-4+/t25-/m1/s1 |
| InChIKey | MZYQPJALSPKQLI-BZSUFZCYSA-N |
| XLogP | 6.96 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|