C25H24BrN3O4S — CID 23976552
[(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23976552) has the molecular formula C25H24BrN3O4S and a molecular weight of 542.46 g/mol. Its IUPAC name is [(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23976552 |
| Molecular Formula | C25H24BrN3O4S |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | [(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@H](C/C=C/C(=O)Nc2ccccc2N)c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C25H24BrN3O4S/c1-34-18-12-10-17(11-13-18)28-25(32)33-23(19-15-16(26)9-14-22(19)30)7-4-8-24(31)29-21-6-3-2-5-20(21)27/h2-6,8-15,23,30H,7,27H2,1H3,(H,28,32)(H,29,31)/b8-4+/t23-/m1/s1 |
| InChIKey | VNODWIDZWVTPEA-VURDRKPISA-N |
| XLogP | 6.33 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|