C26H26IN3O4S — CID 23778873
[(E,1S,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23778873) has the molecular formula C26H26IN3O4S and a molecular weight of 603.48 g/mol. Its IUPAC name is [(E,1S,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1S,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23778873 |
| Molecular Formula | C26H26IN3O4S |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | [(E,1S,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@H](c2cc(I)ccc2O)[C@H](C)/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C26H26IN3O4S/c1-16(7-14-24(32)30-22-6-4-3-5-21(22)28)25(20-15-17(27)8-13-23(20)31)34-26(33)29-18-9-11-19(35-2)12-10-18/h3-16,25,31H,28H2,1-2H3,(H,29,33)(H,30,32)/b14-7+/t16-,25+/m1/s1 |
| InChIKey | MFOQXJKTDMJVII-AIYOWAKSSA-N |
| XLogP | 6.42 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|