C19H18INO5 — CID 23807866
(E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-(phenylcarbamoyloxy)pent-2-enoic acid (PubChem CID 23807866) has the molecular formula C19H18INO5 and a molecular weight of 467.26 g/mol. Its IUPAC name is (E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-(phenylcarbamoyloxy)pent-2-enoic acid.
| Compound Name | (E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-(phenylcarbamoyloxy)pent-2-enoic acid |
|---|---|
| PubChem CID | 23807866 |
| Molecular Formula | C19H18INO5 |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | (E,4R,5S)-5-(2-hydroxy-5-iodophenyl)-4-methyl-5-(phenylcarbamoyloxy)pent-2-enoic acid |
| SMILES | C[C@H](/C=C/C(=O)O)[C@H](OC(=O)Nc1ccccc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C19H18INO5/c1-12(7-10-17(23)24)18(15-11-13(20)8-9-16(15)22)26-19(25)21-14-5-3-2-4-6-14/h2-12,18,22H,1H3,(H,21,25)(H,23,24)/b10-7+/t12-,18+/m1/s1 |
| InChIKey | POYZLVHKRMVUID-ZNYFKNOGSA-N |
| XLogP | 4.56 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|