C20H18IN3O5 — CID 23948489
[(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23948489) has the molecular formula C20H18IN3O5 and a molecular weight of 507.28 g/mol. Its IUPAC name is [(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23948489 |
| Molecular Formula | C20H18IN3O5 |
| Molecular Weight | 507.28 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | [(E,1S,2S)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | C[C@@H](/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C20H18IN3O5/c1-12(2-9-18(26)24-28)19(16-10-14(21)5-8-17(16)25)29-20(27)23-15-6-3-13(11-22)4-7-15/h2-10,12,19,25,28H,1H3,(H,23,27)(H,24,26)/b9-2+/t12-,19-/m0/s1 |
| InChIKey | UAZLGDVCFNVFLI-AVSRADNHSA-N |
| XLogP | 3.86 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|