C26H23IN2O7 — CID 23948504
[(E,1R,2R)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23948504) has the molecular formula C26H23IN2O7 and a molecular weight of 602.38 g/mol. Its IUPAC name is [(E,1R,2R)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23948504 |
| Molecular Formula | C26H23IN2O7 |
| Molecular Weight | 602.38 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | [(E,1R,2R)-5-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@H](c2cc(I)ccc2O)[C@@H](/C=C/C(=O)NO)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23IN2O7/c1-16(30)17-7-10-19(11-8-17)28-26(33)36-25(21-15-18(27)9-12-22(21)31)23(13-14-24(32)29-34)35-20-5-3-2-4-6-20/h2-15,23,25,31,34H,1H3,(H,28,33)(H,29,32)/b14-13+/t23-,25-/m1/s1 |
| InChIKey | UHAVBQMPCWBZLD-HGJZCRRWSA-N |
| XLogP | 5.00 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|