C29H26N2O6S — CID 23807735
[(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23807735) has the molecular formula C29H26N2O6S and a molecular weight of 530.60 g/mol. Its IUPAC name is [(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23807735 |
| Molecular Formula | C29H26N2O6S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | [(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2ccc(O)c3ccccc23)[C@H](/C=C/C(=O)NO)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2O6S/c1-38-21-13-11-19(12-14-21)30-29(34)37-28(24-15-16-25(32)23-10-6-5-9-22(23)24)26(17-18-27(33)31-35)36-20-7-3-2-4-8-20/h2-18,26,28,32,35H,1H3,(H,30,34)(H,31,33)/b18-17+/t26-,28-/m0/s1 |
| InChIKey | SHHNTLZMYZKREH-FCLOIEBCSA-N |
| XLogP | 6.07 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|