C23H21NO5S — CID 23948333
(E,5R)-5-(4-hydroxynaphthalen-1-yl)-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid (PubChem CID 23948333) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is (E,5R)-5-(4-hydroxynaphthalen-1-yl)-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid.
| Compound Name | (E,5R)-5-(4-hydroxynaphthalen-1-yl)-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 23948333 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (E,5R)-5-(4-hydroxynaphthalen-1-yl)-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
| SMILES | CSc1ccc(NC(=O)O[C@H](C/C=C/C(=O)O)c2ccc(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H21NO5S/c1-30-16-11-9-15(10-12-16)24-23(28)29-21(7-4-8-22(26)27)19-13-14-20(25)18-6-3-2-5-17(18)19/h2-6,8-14,21,25H,7H2,1H3,(H,24,28)(H,26,27)/b8-4+/t21-/m1/s1 |
| InChIKey | BBBWUGJVMQHEQK-FAZYEBOESA-N |
| XLogP | 5.59 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|