C18H16BrNO5 — CID 23948638
(E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)pent-2-enoic acid (PubChem CID 23948638) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is (E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)pent-2-enoic acid.
| Compound Name | (E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 23948638 |
| Molecular Formula | C18H16BrNO5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)pent-2-enoic acid |
| SMILES | O=C(O)/C=C/C[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H16BrNO5/c19-13-6-8-14(9-7-13)20-18(24)25-16(2-1-3-17(22)23)12-4-10-15(21)11-5-12/h1,3-11,16,21H,2H2,(H,20,24)(H,22,23)/b3-1+/t16-/m1/s1 |
| InChIKey | PNTOATDQUZGVNG-BCMPFUBYSA-N |
| XLogP | 4.48 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|