C19H18BrNO6 — CID 23749951
(E,4S,5S)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid (PubChem CID 23749951) has the molecular formula C19H18BrNO6 and a molecular weight of 436.26 g/mol. Its IUPAC name is (E,4S,5S)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23749951 |
| Molecular Formula | C19H18BrNO6 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | (E,4S,5S)-5-[(4-bromophenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid |
| SMILES | CO[C@@H](/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18BrNO6/c1-26-16(10-11-17(23)24)18(12-2-8-15(22)9-3-12)27-19(25)21-14-6-4-13(20)5-7-14/h2-11,16,18,22H,1H3,(H,21,25)(H,23,24)/b11-10+/t16-,18-/m0/s1 |
| InChIKey | JLCDSXTTXPFTIU-FNPQLZQRSA-N |
| XLogP | 4.10 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|