C20H19BrFNO6 — CID 23892669
(E,4R,5R)-5-[(4-bromophenyl)carbamoyloxy]-4-ethoxy-5-(3-fluoro-4-hydroxyphenyl)pent-2-enoic acid (PubChem CID 23892669) has the molecular formula C20H19BrFNO6 and a molecular weight of 468.28 g/mol. Its IUPAC name is (E,4R,5R)-5-[(4-bromophenyl)carbamoyloxy]-4-ethoxy-5-(3-fluoro-4-hydroxyphenyl)pent-2-enoic acid.
| Compound Name | (E,4R,5R)-5-[(4-bromophenyl)carbamoyloxy]-4-ethoxy-5-(3-fluoro-4-hydroxyphenyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 23892669 |
| Molecular Formula | C20H19BrFNO6 |
| Molecular Weight | 468.28 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | (E,4R,5R)-5-[(4-bromophenyl)carbamoyloxy]-4-ethoxy-5-(3-fluoro-4-hydroxyphenyl)pent-2-enoic acid |
| SMILES | CCO[C@H](/C=C/C(=O)O)[C@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C20H19BrFNO6/c1-2-28-17(9-10-18(25)26)19(12-3-8-16(24)15(22)11-12)29-20(27)23-14-6-4-13(21)5-7-14/h3-11,17,19,24H,2H2,1H3,(H,23,27)(H,25,26)/b10-9+/t17-,19-/m1/s1 |
| InChIKey | JFXDNBMRTYTESC-BBSZANLASA-N |
| XLogP | 4.63 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|