C19H18N2O6 — CID 23976709
[(E,1S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxopent-3-enyl] N-benzoylcarbamate (PubChem CID 23976709) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is [(E,1S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxopent-3-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxopent-3-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23976709 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [(E,1S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxopent-3-enyl] N-benzoylcarbamate |
| SMILES | O=C(/C=C/C[C@H](OC(=O)NC(=O)c1ccccc1)c1ccc(O)cc1)NO |
| InChI | InChI=1S/C19H18N2O6/c22-15-11-9-13(10-12-15)16(7-4-8-17(23)21-26)27-19(25)20-18(24)14-5-2-1-3-6-14/h1-6,8-12,16,22,26H,7H2,(H,21,23)(H,20,24,25)/b8-4+/t16-/m0/s1 |
| InChIKey | QMCWYSJWRWCLFL-YCOJEUHLSA-N |
| XLogP | 2.45 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|