C25H22N2O7 — CID 23779034
[(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-benzoylcarbamate (PubChem CID 23779034) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is [(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23779034 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [(E,1S,2S)-5-(hydroxyamino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-benzoylcarbamate |
| SMILES | O=C(/C=C/[C@H](Oc1ccccc1)[C@@H](OC(=O)NC(=O)c1ccccc1)c1ccc(O)cc1)NO |
| InChI | InChI=1S/C25H22N2O7/c28-19-13-11-17(12-14-19)23(34-25(31)26-24(30)18-7-3-1-4-8-18)21(15-16-22(29)27-32)33-20-9-5-2-6-10-20/h1-16,21,23,28,32H,(H,27,29)(H,26,30,31)/b16-15+/t21-,23-/m0/s1 |
| InChIKey | SNMTYBMCQXCWPH-IFEIPUBUSA-N |
| XLogP | 3.51 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|