C20H18Br2N2O6 — CID 23778737
[(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate (PubChem CID 23778737) has the molecular formula C20H18Br2N2O6 and a molecular weight of 542.18 g/mol. Its IUPAC name is [(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23778737 |
| Molecular Formula | C20H18Br2N2O6 |
| Molecular Weight | 542.18 g/mol |
| Exact Mass | 539.95 |
| IUPAC Name | [(E,1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
| SMILES | C[C@@H](/C=C/C(=O)NO)[C@H](OC(=O)NC(=O)c1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C20H18Br2N2O6/c1-11(7-8-16(25)24-29)18(14-9-13(21)10-15(22)17(14)26)30-20(28)23-19(27)12-5-3-2-4-6-12/h2-11,18,26,29H,1H3,(H,24,25)(H,23,27,28)/b8-7+/t11-,18-/m0/s1 |
| InChIKey | LTEDQQZFDHNRKK-NBHMFPSUSA-N |
| XLogP | 4.22 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|