C23H24Br2N2O7 — CID 23778751
[(E,1R,2R)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-(hydroxyamino)-7-oxohept-5-enyl] N-benzoylcarbamate (PubChem CID 23778751) has the molecular formula C23H24Br2N2O7 and a molecular weight of 600.26 g/mol. Its IUPAC name is [(E,1R,2R)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-(hydroxyamino)-7-oxohept-5-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R,2R)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-(hydroxyamino)-7-oxohept-5-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23778751 |
| Molecular Formula | C23H24Br2N2O7 |
| Molecular Weight | 600.26 g/mol |
| Exact Mass | 598.00 |
| IUPAC Name | [(E,1R,2R)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-(hydroxyamino)-7-oxohept-5-enyl] N-benzoylcarbamate |
| SMILES | CCO[C@H](CC/C=C/C(=O)NO)[C@H](OC(=O)NC(=O)c1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C23H24Br2N2O7/c1-2-33-18(10-6-7-11-19(28)27-32)21(16-12-15(24)13-17(25)20(16)29)34-23(31)26-22(30)14-8-4-3-5-9-14/h3-5,7-9,11-13,18,21,29,32H,2,6,10H2,1H3,(H,27,28)(H,26,30,31)/b11-7+/t18-,21-/m1/s1 |
| InChIKey | VQSBUIALUXPXQQ-YMEXETMUSA-N |
| XLogP | 4.77 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|