C22H26N2O6 — CID 23807994
[(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxohept-5-enyl] N-phenylcarbamate (PubChem CID 23807994) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is [(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxohept-5-enyl] N-phenylcarbamate.
| Compound Name | [(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxohept-5-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23807994 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(4-hydroxyphenyl)-7-oxohept-5-enyl] N-phenylcarbamate |
| SMILES | CCO[C@H](CC/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H26N2O6/c1-2-29-19(10-6-7-11-20(26)24-28)21(16-12-14-18(25)15-13-16)30-22(27)23-17-8-4-3-5-9-17/h3-5,7-9,11-15,19,21,25,28H,2,6,10H2,1H3,(H,23,27)(H,24,26)/b11-7+/t19-,21-/m1/s1 |
| InChIKey | ILXMWJBDHPOAEY-RZPVRENCSA-N |
| XLogP | 3.93 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|