C24H27IN2O7 — CID 23920680
[(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23920680) has the molecular formula C24H27IN2O7 and a molecular weight of 582.39 g/mol. Its IUPAC name is [(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23920680 |
| Molecular Formula | C24H27IN2O7 |
| Molecular Weight | 582.39 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | [(E,1R,2R)-2-ethoxy-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CCO[C@H](CC/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc(C(C)=O)cc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C24H27IN2O7/c1-3-33-21(6-4-5-7-22(30)27-32)23(19-14-17(25)10-13-20(19)29)34-24(31)26-18-11-8-16(9-12-18)15(2)28/h5,7-14,21,23,29,32H,3-4,6H2,1-2H3,(H,26,31)(H,27,30)/b7-5+/t21-,23-/m1/s1 |
| InChIKey | AAWGAXXPCUAJAR-QAMVVPEXSA-N |
| XLogP | 4.74 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|