C23H25FN2O7 — CID 23920734
[(E,1R,2R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methoxy-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23920734) has the molecular formula C23H25FN2O7 and a molecular weight of 460.46 g/mol. Its IUPAC name is [(E,1R,2R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methoxy-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methoxy-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23920734 |
| Molecular Formula | C23H25FN2O7 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [(E,1R,2R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2-methoxy-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CO[C@H](CC/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc(C(C)=O)cc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C23H25FN2O7/c1-14(27)15-7-10-17(11-8-15)25-23(30)33-22(16-9-12-19(28)18(24)13-16)20(32-2)5-3-4-6-21(29)26-31/h4,6-13,20,22,28,31H,3,5H2,1-2H3,(H,25,30)(H,26,29)/b6-4+/t20-,22-/m1/s1 |
| InChIKey | TVXWPJNOVFLHJM-CDVAYIFPSA-N |
| XLogP | 3.88 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|