C24H29NO7 — CID 23893094
(E,6S,7S)-6-ethoxy-7-[4-(2-hydroxyethoxy)phenyl]-7-(phenylcarbamoyloxy)hept-2-enoic acid (PubChem CID 23893094) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is (E,6S,7S)-6-ethoxy-7-[4-(2-hydroxyethoxy)phenyl]-7-(phenylcarbamoyloxy)hept-2-enoic acid.
| Compound Name | (E,6S,7S)-6-ethoxy-7-[4-(2-hydroxyethoxy)phenyl]-7-(phenylcarbamoyloxy)hept-2-enoic acid |
|---|---|
| PubChem CID | 23893094 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (E,6S,7S)-6-ethoxy-7-[4-(2-hydroxyethoxy)phenyl]-7-(phenylcarbamoyloxy)hept-2-enoic acid |
| SMILES | CCO[C@@H](CC/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccccc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C24H29NO7/c1-2-30-21(10-6-7-11-22(27)28)23(18-12-14-20(15-13-18)31-17-16-26)32-24(29)25-19-8-4-3-5-9-19/h3-5,7-9,11-15,21,23,26H,2,6,10,16-17H2,1H3,(H,25,29)(H,27,28)/b11-7+/t21-,23-/m0/s1 |
| InChIKey | OZQYBTRHOHWEGU-TYPFIXKOSA-N |
| XLogP | 4.17 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|