C24H28N2O7S — CID 23921129
[(3S,4S)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-[4-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate (PubChem CID 23921129) has the molecular formula C24H28N2O7S and a molecular weight of 488.56 g/mol. Its IUPAC name is [(3S,4S)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-[4-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate.
| Compound Name | [(3S,4S)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-[4-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23921129 |
| Molecular Formula | C24H28N2O7S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [(3S,4S)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-[4-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate |
| SMILES | CCO[C@@H](CCOC(=O)CS)[C@@H](OC(=O)Nc1ccc(C#N)cc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C24H28N2O7S/c1-2-30-21(11-13-32-22(28)16-34)23(18-5-9-20(10-6-18)31-14-12-27)33-24(29)26-19-7-3-17(15-25)4-8-19/h3-10,21,23,27,34H,2,11-14,16H2,1H3,(H,26,29)/t21-,23-/m0/s1 |
| InChIKey | COVATYWPHUSNFB-GMAHTHKFSA-N |
| XLogP | 3.49 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|