C22H23IN2O6S — CID 23948497
[(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-(2-hydroxy-5-iodophenyl)butyl] 2-sulfanylacetate (PubChem CID 23948497) has the molecular formula C22H23IN2O6S and a molecular weight of 570.41 g/mol. Its IUPAC name is [(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-(2-hydroxy-5-iodophenyl)butyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-(2-hydroxy-5-iodophenyl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23948497 |
| Molecular Formula | C22H23IN2O6S |
| Molecular Weight | 570.41 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | [(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-3-ethoxy-4-(2-hydroxy-5-iodophenyl)butyl] 2-sulfanylacetate |
| SMILES | CCO[C@H](CCOC(=O)CS)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C22H23IN2O6S/c1-2-29-19(9-10-30-20(27)13-32)21(17-11-15(23)5-8-18(17)26)31-22(28)25-16-6-3-14(12-24)4-7-16/h3-8,11,19,21,26,32H,2,9-10,13H2,1H3,(H,25,28)/t19-,21-/m1/s1 |
| InChIKey | JWESXXZYFBOTDN-TZIWHRDSSA-N |
| XLogP | 4.43 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|