C21H22INO7S — CID 23778901
[(3S,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(2-hydroxy-5-iodophenyl)-3-methylbutyl] 2-sulfanylacetate (PubChem CID 23778901) has the molecular formula C21H22INO7S and a molecular weight of 559.38 g/mol. Its IUPAC name is [(3S,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(2-hydroxy-5-iodophenyl)-3-methylbutyl] 2-sulfanylacetate.
| Compound Name | [(3S,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(2-hydroxy-5-iodophenyl)-3-methylbutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23778901 |
| Molecular Formula | C21H22INO7S |
| Molecular Weight | 559.38 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | [(3S,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(2-hydroxy-5-iodophenyl)-3-methylbutyl] 2-sulfanylacetate |
| SMILES | C[C@@H](CCOC(=O)CS)[C@@H](OC(=O)Nc1ccc2c(c1)OCO2)c1cc(I)ccc1O |
| InChI | InChI=1S/C21H22INO7S/c1-12(6-7-27-19(25)10-31)20(15-8-13(22)2-4-16(15)24)30-21(26)23-14-3-5-17-18(9-14)29-11-28-17/h2-5,8-9,12,20,24,31H,6-7,10-11H2,1H3,(H,23,26)/t12-,20+/m0/s1 |
| InChIKey | FNDYZJRICMFFCX-FKIZINRSSA-N |
| XLogP | 4.51 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|