C25H24INO6S — CID 23836540
[(3R,4R)-4-(2-hydroxy-5-iodophenyl)-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate (PubChem CID 23836540) has the molecular formula C25H24INO6S and a molecular weight of 593.44 g/mol. Its IUPAC name is [(3R,4R)-4-(2-hydroxy-5-iodophenyl)-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-(2-hydroxy-5-iodophenyl)-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23836540 |
| Molecular Formula | C25H24INO6S |
| Molecular Weight | 593.44 g/mol |
| Exact Mass | 593.04 |
| IUPAC Name | [(3R,4R)-4-(2-hydroxy-5-iodophenyl)-3-phenoxy-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
| SMILES | O=C(CS)OCC[C@@H](Oc1ccccc1)[C@H](OC(=O)Nc1ccccc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C25H24INO6S/c26-17-11-12-21(28)20(15-17)24(33-25(30)27-18-7-3-1-4-8-18)22(13-14-31-23(29)16-34)32-19-9-5-2-6-10-19/h1-12,15,22,24,28,34H,13-14,16H2,(H,27,30)/t22-,24-/m1/s1 |
| InChIKey | AGTJCZMOQKVNOA-ISKFKSNPSA-N |
| XLogP | 5.60 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|