C27H27NO9S — CID 23920427
[(3R,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate (PubChem CID 23920427) has the molecular formula C27H27NO9S and a molecular weight of 541.58 g/mol. Its IUPAC name is [(3R,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23920427 |
| Molecular Formula | C27H27NO9S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | [(3R,4R)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccc3c(c2)OCO3)[C@@H](CCOC(=O)CS)Oc2ccccc2)cc1O |
| InChI | InChI=1S/C27H27NO9S/c1-32-21-9-7-17(13-20(21)29)26(37-27(31)28-18-8-10-22-24(14-18)35-16-34-22)23(11-12-33-25(30)15-38)36-19-5-3-2-4-6-19/h2-10,13-14,23,26,29,38H,11-12,15-16H2,1H3,(H,28,31)/t23-,26-/m1/s1 |
| InChIKey | FPDDXHXOQIHWJR-ZEQKJWHPSA-N |
| XLogP | 4.73 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|