C20H21NO7S — CID 23892710
[(4S)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate (PubChem CID 23892710) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is [(4S)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate.
| Compound Name | [(4S)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23892710 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [(4S)-4-(1,3-benzodioxol-5-ylcarbamoyloxy)-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate |
| SMILES | O=C(CS)OCCC[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H21NO7S/c22-15-6-3-13(4-7-15)16(2-1-9-25-19(23)11-29)28-20(24)21-14-5-8-17-18(10-14)27-12-26-17/h3-8,10,16,22,29H,1-2,9,11-12H2,(H,21,24)/t16-/m0/s1 |
| InChIKey | XWYPENMPLDVZCA-INIZCTEOSA-N |
| XLogP | 3.66 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|