C20H21Br2NO5S — CID 23892491
[(4R)-4-(3,5-dibromo-2-hydroxyphenyl)-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate (PubChem CID 23892491) has the molecular formula C20H21Br2NO5S and a molecular weight of 547.27 g/mol. Its IUPAC name is [(4R)-4-(3,5-dibromo-2-hydroxyphenyl)-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate.
| Compound Name | [(4R)-4-(3,5-dibromo-2-hydroxyphenyl)-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23892491 |
| Molecular Formula | C20H21Br2NO5S |
| Molecular Weight | 547.27 g/mol |
| Exact Mass | 544.95 |
| IUPAC Name | [(4R)-4-(3,5-dibromo-2-hydroxyphenyl)-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate |
| SMILES | Cc1ccc(NC(=O)O[C@H](CCCOC(=O)CS)c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C20H21Br2NO5S/c1-12-4-6-14(7-5-12)23-20(26)28-17(3-2-8-27-18(24)11-29)15-9-13(21)10-16(22)19(15)25/h4-7,9-10,17,25,29H,2-3,8,11H2,1H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | OMANMFWICNLHBI-QGZVFWFLSA-N |
| XLogP | 5.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.27 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|