C21H24BrNO6S — CID 23808165
[(4R)-4-[(4-bromophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate (PubChem CID 23808165) has the molecular formula C21H24BrNO6S and a molecular weight of 498.40 g/mol. Its IUPAC name is [(4R)-4-[(4-bromophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate.
| Compound Name | [(4R)-4-[(4-bromophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23808165 |
| Molecular Formula | C21H24BrNO6S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | [(4R)-4-[(4-bromophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]butyl] 2-sulfanylacetate |
| SMILES | O=C(CS)OCCC[C@@H](OC(=O)Nc1ccc(Br)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C21H24BrNO6S/c22-16-6-8-17(9-7-16)23-21(26)29-19(5-2-11-28-20(25)14-30)15-3-1-4-18(13-15)27-12-10-24/h1,3-4,6-9,13,19,24,30H,2,5,10-12,14H2,(H,23,26)/t19-/m1/s1 |
| InChIKey | JVHKSMIZWXRSTC-LJQANCHMSA-N |
| XLogP | 4.36 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|